C18H19BrN4OS — CID 75402686
N'-(4-bromophenyl)-2-[2,5-dimethyl-3-(2-methyl-1,3-thiazol-4-yl)pyrrol-1-yl]acetohydrazide (PubChem CID 75402686) has the molecular formula C18H19BrN4OS and a molecular weight of 419.35 g/mol. Its IUPAC name is N'-(4-bromophenyl)-2-[2,5-dimethyl-3-(2-methyl-1,3-thiazol-4-yl)pyrrol-1-yl]acetohydrazide.
| Compound Name | N'-(4-bromophenyl)-2-[2,5-dimethyl-3-(2-methyl-1,3-thiazol-4-yl)pyrrol-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 75402686 |
| Molecular Formula | C18H19BrN4OS |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | N'-(4-bromophenyl)-2-[2,5-dimethyl-3-(2-methyl-1,3-thiazol-4-yl)pyrrol-1-yl]acetohydrazide |
| SMILES | Cc1nc(-c2cc(C)n(CC(=O)NNc3ccc(Br)cc3)c2C)cs1 |
| InChI | InChI=1S/C18H19BrN4OS/c1-11-8-16(17-10-25-13(3)20-17)12(2)23(11)9-18(24)22-21-15-6-4-14(19)5-7-15/h4-8,10,21H,9H2,1-3H3,(H,22,24) |
| InChIKey | JOOSHGIGFZWDTG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|