C16H19N3OS — CID 75403017
N-(2-cyclopentylsulfanylethyl)quinoxaline-2-carboxamide (PubChem CID 75403017) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is N-(2-cyclopentylsulfanylethyl)quinoxaline-2-carboxamide.
| Compound Name | N-(2-cyclopentylsulfanylethyl)quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 75403017 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-(2-cyclopentylsulfanylethyl)quinoxaline-2-carboxamide |
| SMILES | O=C(NCCSC1CCCC1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C16H19N3OS/c20-16(17-9-10-21-12-5-1-2-6-12)15-11-18-13-7-3-4-8-14(13)19-15/h3-4,7-8,11-12H,1-2,5-6,9-10H2,(H,17,20) |
| InChIKey | PSYRLZJWNTUZSG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|