C21H28N4O2 — CID 75403188
1-(4-methylphenyl)-6-oxo-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-2,5-dihydro-1,2,4-triazine-3-carboxamide (PubChem CID 75403188) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-(4-methylphenyl)-6-oxo-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-2,5-dihydro-1,2,4-triazine-3-carboxamide.
| Compound Name | 1-(4-methylphenyl)-6-oxo-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-2,5-dihydro-1,2,4-triazine-3-carboxamide |
|---|---|
| PubChem CID | 75403188 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 1-(4-methylphenyl)-6-oxo-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-2,5-dihydro-1,2,4-triazine-3-carboxamide |
| SMILES | Cc1ccc(N2NC(C(=O)NC3CC4CCC3(C)C4(C)C)=NCC2=O)cc1 |
| InChI | InChI=1S/C21H28N4O2/c1-13-5-7-15(8-6-13)25-17(26)12-22-18(24-25)19(27)23-16-11-14-9-10-21(16,4)20(14,2)3/h5-8,14,16H,9-12H2,1-4H3,(H,22,24)(H,23,27) |
| InChIKey | HSPSVWYLEVIPIP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |