About N-(4-hydroxyphenyl)-2,4,6-trimethylbenzenesulfonamide
N-(4-hydroxyphenyl)-2,4,6-trimethylbenzenesulfonamide (PubChem CID 754032) has the molecular formula C15H17NO3S
and a molecular weight of 291.37 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-2,4,6-trimethylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-(4-hydroxyphenyl)-2,4,6-trimethylbenzenesulfonamide |
| PubChem CID | 754032 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-(4-hydroxyphenyl)-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2ccc(O)cc2)c(C)c1 |
| InChI | InChI=1S/C15H17NO3S/c1-10-8-11(2)15(12(3)9-10)20(18,19)16-13-4-6-14(17)7-5-13/h4-9,16-17H,1-3H3 |
| InChIKey | CXFFIBYHIRNNLG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze N-(4-hydroxyphenyl)-2,4,6-trimethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxyphenyl)-2,4,6-trimethylbenzenesulfonamide?
The IUPAC name of N-(4-hydroxyphenyl)-2,4,6-trimethylbenzenesulfonamide (CID 754032) is N-(4-hydroxyphenyl)-2,4,6-trimethylbenzenesulfonamide.
What is the SMILES notation for N-(4-hydroxyphenyl)-2,4,6-trimethylbenzenesulfonamide?
The canonical SMILES for N-(4-hydroxyphenyl)-2,4,6-trimethylbenzenesulfonamide is Cc1cc(C)c(S(=O)(=O)Nc2ccc(O)cc2)c(C)c1.
What is the InChIKey of N-(4-hydroxyphenyl)-2,4,6-trimethylbenzenesulfonamide?
The InChIKey is CXFFIBYHIRNNLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3S/c1-10-8-11(2)15(12(3)9-10)20(18,19)16-13-4-6-14(17)7-5-13/h4-9,16-17H,1-3H3.
What are the key properties of N-(4-hydroxyphenyl)-2,4,6-trimethylbenzenesulfonamide?
N-(4-hydroxyphenyl)-2,4,6-trimethylbenzenesulfonamide has a molecular weight of 291.37 g/mol, XLogP of 3.12, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxyphenyl)-2,4,6-trimethylbenzenesulfonamide is sourced from PubChem (CID 754032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).