C21H21F2N3O2 — CID 75403881
N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-4-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 75403881) has the molecular formula C21H21F2N3O2 and a molecular weight of 385.41 g/mol. Its IUPAC name is N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-4-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-4-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 75403881 |
| Molecular Formula | C21H21F2N3O2 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-4-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | O=C(Nc1cc(F)c(N2CCCC2)c(F)c1)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C21H21F2N3O2/c22-17-12-15(13-18(23)20(17)25-9-1-2-10-25)24-21(28)14-5-7-16(8-6-14)26-11-3-4-19(26)27/h5-8,12-13H,1-4,9-11H2,(H,24,28) |
| InChIKey | ITLVHTKSLKPDET-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|