C13H16ClF3N4O2S — CID 75404403
2-chloro-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]imidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 75404403) has the molecular formula C13H16ClF3N4O2S and a molecular weight of 384.81 g/mol. Its IUPAC name is 2-chloro-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]imidazo[1,2-a]pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]imidazo[1,2-a]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 75404403 |
| Molecular Formula | C13H16ClF3N4O2S |
| Molecular Weight | 384.81 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 2-chloro-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]imidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | CN(CCCNS(=O)(=O)c1c(Cl)nc2ccccn12)CC(F)(F)F |
| InChI | InChI=1S/C13H16ClF3N4O2S/c1-20(9-13(15,16)17)7-4-6-18-24(22,23)12-11(14)19-10-5-2-3-8-21(10)12/h2-3,5,8,18H,4,6-7,9H2,1H3 |
| InChIKey | XTMWQOPXJOWKEY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.81 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|