C18H24N2O4S — CID 75405283
[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl 2-[methyl(pyridin-3-ylsulfonyl)amino]acetate (PubChem CID 75405283) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl 2-[methyl(pyridin-3-ylsulfonyl)amino]acetate.
| Compound Name | [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl 2-[methyl(pyridin-3-ylsulfonyl)amino]acetate |
|---|---|
| PubChem CID | 75405283 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl 2-[methyl(pyridin-3-ylsulfonyl)amino]acetate |
| SMILES | CN(CC(=O)OCC1=CC[C@H]2C[C@@H]1C2(C)C)S(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C18H24N2O4S/c1-18(2)14-7-6-13(16(18)9-14)12-24-17(21)11-20(3)25(22,23)15-5-4-8-19-10-15/h4-6,8,10,14,16H,7,9,11-12H2,1-3H3/t14-,16-/m0/s1 |
| InChIKey | RKIIOQACKUSWMA-HOCLYGCPSA-N |
| XLogP | 2.24 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|