C17H18ClFN4O2 — CID 75405537
5-chloro-N-[2-(3-fluorophenyl)-2-hydroxyethyl]-2-pyrrolidin-1-ylpyrimidine-4-carboxamide (PubChem CID 75405537) has the molecular formula C17H18ClFN4O2 and a molecular weight of 364.81 g/mol. Its IUPAC name is 5-chloro-N-[2-(3-fluorophenyl)-2-hydroxyethyl]-2-pyrrolidin-1-ylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-[2-(3-fluorophenyl)-2-hydroxyethyl]-2-pyrrolidin-1-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 75405537 |
| Molecular Formula | C17H18ClFN4O2 |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 5-chloro-N-[2-(3-fluorophenyl)-2-hydroxyethyl]-2-pyrrolidin-1-ylpyrimidine-4-carboxamide |
| SMILES | O=C(NCC(O)c1cccc(F)c1)c1nc(N2CCCC2)ncc1Cl |
| InChI | InChI=1S/C17H18ClFN4O2/c18-13-9-21-17(23-6-1-2-7-23)22-15(13)16(25)20-10-14(24)11-4-3-5-12(19)8-11/h3-5,8-9,14,24H,1-2,6-7,10H2,(H,20,25) |
| InChIKey | LJTNXISSYJYPPA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |