About (2-oxooxolan-3-yl) 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate
(2-oxooxolan-3-yl) 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate (PubChem CID 75405859) has the molecular formula C14H16N2O4S2
and a molecular weight of 340.43 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate.
Molecular Properties
| Compound Name | (2-oxooxolan-3-yl) 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate |
| PubChem CID | 75405859 |
| Molecular Formula | C14H16N2O4S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | (2-oxooxolan-3-yl) 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate |
| SMILES | CCN(CC)c1nc2sc(C(=O)OC3CCOC3=O)cc2s1 |
| InChI | InChI=1S/C14H16N2O4S2/c1-3-16(4-2)14-15-11-9(22-14)7-10(21-11)13(18)20-8-5-6-19-12(8)17/h7-8H,3-6H2,1-2H3 |
| InChIKey | ZCYXVHKLDRVRDD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (2-oxooxolan-3-yl) 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxooxolan-3-yl) 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate?
The IUPAC name of (2-oxooxolan-3-yl) 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate (CID 75405859) is (2-oxooxolan-3-yl) 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate.
What is the SMILES notation for (2-oxooxolan-3-yl) 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate?
The canonical SMILES for (2-oxooxolan-3-yl) 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate is CCN(CC)c1nc2sc(C(=O)OC3CCOC3=O)cc2s1.
What is the InChIKey of (2-oxooxolan-3-yl) 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate?
The InChIKey is ZCYXVHKLDRVRDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O4S2/c1-3-16(4-2)14-15-11-9(22-14)7-10(21-11)13(18)20-8-5-6-19-12(8)17/h7-8H,3-6H2,1-2H3.
What are the key properties of (2-oxooxolan-3-yl) 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate?
(2-oxooxolan-3-yl) 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate has a molecular weight of 340.43 g/mol, XLogP of 2.68, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxooxolan-3-yl) 2-(diethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate is sourced from PubChem (CID 75405859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).