About 1-(5-methyl-1H-pyrazol-4-yl)-3-(1,3-thiazol-2-yl)urea
1-(5-methyl-1H-pyrazol-4-yl)-3-(1,3-thiazol-2-yl)urea (PubChem CID 75405901) has the molecular formula C8H9N5OS
and a molecular weight of 223.26 g/mol. Its IUPAC name is 1-(5-methyl-1H-pyrazol-4-yl)-3-(1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-(5-methyl-1H-pyrazol-4-yl)-3-(1,3-thiazol-2-yl)urea |
| PubChem CID | 75405901 |
| Molecular Formula | C8H9N5OS |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 1-(5-methyl-1H-pyrazol-4-yl)-3-(1,3-thiazol-2-yl)urea |
| SMILES | Cc1[nH]ncc1NC(=O)Nc1nccs1 |
| InChI | InChI=1S/C8H9N5OS/c1-5-6(4-10-13-5)11-7(14)12-8-9-2-3-15-8/h2-4H,1H3,(H,10,13)(H2,9,11,12,14) |
| InChIKey | NWDASYWGZUNOEI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-methyl-1H-pyrazol-4-yl)-3-(1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methyl-1H-pyrazol-4-yl)-3-(1,3-thiazol-2-yl)urea?
The IUPAC name of 1-(5-methyl-1H-pyrazol-4-yl)-3-(1,3-thiazol-2-yl)urea (CID 75405901) is 1-(5-methyl-1H-pyrazol-4-yl)-3-(1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1-(5-methyl-1H-pyrazol-4-yl)-3-(1,3-thiazol-2-yl)urea?
The canonical SMILES for 1-(5-methyl-1H-pyrazol-4-yl)-3-(1,3-thiazol-2-yl)urea is Cc1[nH]ncc1NC(=O)Nc1nccs1.
What is the InChIKey of 1-(5-methyl-1H-pyrazol-4-yl)-3-(1,3-thiazol-2-yl)urea?
The InChIKey is NWDASYWGZUNOEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5OS/c1-5-6(4-10-13-5)11-7(14)12-8-9-2-3-15-8/h2-4H,1H3,(H,10,13)(H2,9,11,12,14).
What are the key properties of 1-(5-methyl-1H-pyrazol-4-yl)-3-(1,3-thiazol-2-yl)urea?
1-(5-methyl-1H-pyrazol-4-yl)-3-(1,3-thiazol-2-yl)urea has a molecular weight of 223.26 g/mol, XLogP of 1.82, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methyl-1H-pyrazol-4-yl)-3-(1,3-thiazol-2-yl)urea is sourced from PubChem (CID 75405901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).