C9Cl3F9 — CID 75406204
1,3,5-trichloro-2,4,6-tris(trifluoromethyl)benzene (PubChem CID 75406204) has the molecular formula C9Cl3F9 and a molecular weight of 385.44 g/mol. Its IUPAC name is 1,3,5-trichloro-2,4,6-tris(trifluoromethyl)benzene.
| Compound Name | 1,3,5-trichloro-2,4,6-tris(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 75406204 |
| Molecular Formula | C9Cl3F9 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 383.89 |
| IUPAC Name | 1,3,5-trichloro-2,4,6-tris(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1c(Cl)c(C(F)(F)F)c(Cl)c(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C9Cl3F9/c10-4-1(7(13,14)15)5(11)3(9(19,20)21)6(12)2(4)8(16,17)18 |
| InChIKey | ZKLBYVLEBIWSAL-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |