C7H4F5NS — CID 75406426
5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridine-2-thione (PubChem CID 75406426) has the molecular formula C7H4F5NS and a molecular weight of 229.17 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridine-2-thione.
| Compound Name | 5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridine-2-thione |
|---|---|
| PubChem CID | 75406426 |
| Molecular Formula | C7H4F5NS |
| Molecular Weight | 229.17 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | 5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridine-2-thione |
| SMILES | FC(F)(F)C(F)(F)c1ccc(=S)[nH]c1 |
| InChI | InChI=1S/C7H4F5NS/c8-6(9,7(10,11)12)4-1-2-5(14)13-3-4/h1-3H,(H,13,14) |
| InChIKey | WGBBPSYUNXBVFC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.17 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|