C18H28N4O3 — CID 75407115
[4-(ethylcarbamoylamino)cyclohexyl] (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate (PubChem CID 75407115) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is [4-(ethylcarbamoylamino)cyclohexyl] (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [4-(ethylcarbamoylamino)cyclohexyl] (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 75407115 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | [4-(ethylcarbamoylamino)cyclohexyl] (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate |
| SMILES | CCNC(=O)NC1CCC(OC(=O)/C=C/c2c(C)nn(C)c2C)CC1 |
| InChI | InChI=1S/C18H28N4O3/c1-5-19-18(24)20-14-6-8-15(9-7-14)25-17(23)11-10-16-12(2)21-22(4)13(16)3/h10-11,14-15H,5-9H2,1-4H3,(H2,19,20,24)/b11-10+ |
| InChIKey | QGKJDBYGAXJEJQ-ZHACJKMWSA-N |
| XLogP | 2.22 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|