C17H31NO3S — CID 75407298
N-[4-(2-methylbutan-2-yl)cyclohexyl]-1,1-dioxothiane-4-carboxamide (PubChem CID 75407298) has the molecular formula C17H31NO3S and a molecular weight of 329.51 g/mol. Its IUPAC name is N-[4-(2-methylbutan-2-yl)cyclohexyl]-1,1-dioxothiane-4-carboxamide.
| Compound Name | N-[4-(2-methylbutan-2-yl)cyclohexyl]-1,1-dioxothiane-4-carboxamide |
|---|---|
| PubChem CID | 75407298 |
| Molecular Formula | C17H31NO3S |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | N-[4-(2-methylbutan-2-yl)cyclohexyl]-1,1-dioxothiane-4-carboxamide |
| SMILES | CCC(C)(C)C1CCC(NC(=O)C2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C17H31NO3S/c1-4-17(2,3)14-5-7-15(8-6-14)18-16(19)13-9-11-22(20,21)12-10-13/h13-15H,4-12H2,1-3H3,(H,18,19) |
| InChIKey | YSGUMPJEZYHDCU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |