About N-(4-butylcyclohexyl)-N'-(3,5-dimethyl-1,2-oxazol-4-yl)oxamide
N-(4-butylcyclohexyl)-N'-(3,5-dimethyl-1,2-oxazol-4-yl)oxamide (PubChem CID 75407605) has the molecular formula C17H27N3O3
and a molecular weight of 321.42 g/mol. Its IUPAC name is N-(4-butylcyclohexyl)-N'-(3,5-dimethyl-1,2-oxazol-4-yl)oxamide.
Molecular Properties
| Compound Name | N-(4-butylcyclohexyl)-N'-(3,5-dimethyl-1,2-oxazol-4-yl)oxamide |
| PubChem CID | 75407605 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | N-(4-butylcyclohexyl)-N'-(3,5-dimethyl-1,2-oxazol-4-yl)oxamide |
| SMILES | CCCCC1CCC(NC(=O)C(=O)Nc2c(C)noc2C)CC1 |
| InChI | InChI=1S/C17H27N3O3/c1-4-5-6-13-7-9-14(10-8-13)18-16(21)17(22)19-15-11(2)20-23-12(15)3/h13-14H,4-10H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | MQYCPBCMNZTMMR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(4-butylcyclohexyl)-N'-(3,5-dimethyl-1,2-oxazol-4-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-butylcyclohexyl)-N'-(3,5-dimethyl-1,2-oxazol-4-yl)oxamide?
The IUPAC name of N-(4-butylcyclohexyl)-N'-(3,5-dimethyl-1,2-oxazol-4-yl)oxamide (CID 75407605) is N-(4-butylcyclohexyl)-N'-(3,5-dimethyl-1,2-oxazol-4-yl)oxamide.
What is the SMILES notation for N-(4-butylcyclohexyl)-N'-(3,5-dimethyl-1,2-oxazol-4-yl)oxamide?
The canonical SMILES for N-(4-butylcyclohexyl)-N'-(3,5-dimethyl-1,2-oxazol-4-yl)oxamide is CCCCC1CCC(NC(=O)C(=O)Nc2c(C)noc2C)CC1.
What is the InChIKey of N-(4-butylcyclohexyl)-N'-(3,5-dimethyl-1,2-oxazol-4-yl)oxamide?
The InChIKey is MQYCPBCMNZTMMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N3O3/c1-4-5-6-13-7-9-14(10-8-13)18-16(21)17(22)19-15-11(2)20-23-12(15)3/h13-14H,4-10H2,1-3H3,(H,18,21)(H,19,22).
What are the key properties of N-(4-butylcyclohexyl)-N'-(3,5-dimethyl-1,2-oxazol-4-yl)oxamide?
N-(4-butylcyclohexyl)-N'-(3,5-dimethyl-1,2-oxazol-4-yl)oxamide has a molecular weight of 321.42 g/mol, XLogP of 3.10, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-butylcyclohexyl)-N'-(3,5-dimethyl-1,2-oxazol-4-yl)oxamide is sourced from PubChem (CID 75407605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).