About (1,1-dioxo-1,4-thiazinan-4-yl)-(4-methylcyclohexyl)methanone
(1,1-dioxo-1,4-thiazinan-4-yl)-(4-methylcyclohexyl)methanone (PubChem CID 75407745) has the molecular formula C12H21NO3S
and a molecular weight of 259.37 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazinan-4-yl)-(4-methylcyclohexyl)methanone.
Molecular Properties
| Compound Name | (1,1-dioxo-1,4-thiazinan-4-yl)-(4-methylcyclohexyl)methanone |
| PubChem CID | 75407745 |
| Molecular Formula | C12H21NO3S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (1,1-dioxo-1,4-thiazinan-4-yl)-(4-methylcyclohexyl)methanone |
| SMILES | CC1CCC(C(=O)N2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C12H21NO3S/c1-10-2-4-11(5-3-10)12(14)13-6-8-17(15,16)9-7-13/h10-11H,2-9H2,1H3 |
| InChIKey | PIIQFGIQLCWAHK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1,1-dioxo-1,4-thiazinan-4-yl)-(4-methylcyclohexyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,1-dioxo-1,4-thiazinan-4-yl)-(4-methylcyclohexyl)methanone?
The IUPAC name of (1,1-dioxo-1,4-thiazinan-4-yl)-(4-methylcyclohexyl)methanone (CID 75407745) is (1,1-dioxo-1,4-thiazinan-4-yl)-(4-methylcyclohexyl)methanone.
What is the SMILES notation for (1,1-dioxo-1,4-thiazinan-4-yl)-(4-methylcyclohexyl)methanone?
The canonical SMILES for (1,1-dioxo-1,4-thiazinan-4-yl)-(4-methylcyclohexyl)methanone is CC1CCC(C(=O)N2CCS(=O)(=O)CC2)CC1.
What is the InChIKey of (1,1-dioxo-1,4-thiazinan-4-yl)-(4-methylcyclohexyl)methanone?
The InChIKey is PIIQFGIQLCWAHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3S/c1-10-2-4-11(5-3-10)12(14)13-6-8-17(15,16)9-7-13/h10-11H,2-9H2,1H3.
What are the key properties of (1,1-dioxo-1,4-thiazinan-4-yl)-(4-methylcyclohexyl)methanone?
(1,1-dioxo-1,4-thiazinan-4-yl)-(4-methylcyclohexyl)methanone has a molecular weight of 259.37 g/mol, XLogP of 1.07, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-dioxo-1,4-thiazinan-4-yl)-(4-methylcyclohexyl)methanone is sourced from PubChem (CID 75407745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).