C13H21NO2S — CID 75408244
(2E,4E)-N-[(2-ethylsulfanyl-1-hydroxycyclobutyl)methyl]hexa-2,4-dienamide (PubChem CID 75408244) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is (2E,4E)-N-[(2-ethylsulfanyl-1-hydroxycyclobutyl)methyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[(2-ethylsulfanyl-1-hydroxycyclobutyl)methyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 75408244 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (2E,4E)-N-[(2-ethylsulfanyl-1-hydroxycyclobutyl)methyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)NCC1(O)CCC1SCC |
| InChI | InChI=1S/C13H21NO2S/c1-3-5-6-7-12(15)14-10-13(16)9-8-11(13)17-4-2/h3,5-7,11,16H,4,8-10H2,1-2H3,(H,14,15)/b5-3+,7-6+ |
| InChIKey | KVHYKVUQKSXILQ-TWTPFVCWSA-N |
| XLogP | 1.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|