About methyl 2-[(2R,3R,4R)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]benzoate
methyl 2-[(2R,3R,4R)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]benzoate (PubChem CID 75409825) has the molecular formula C20H17FO6
and a molecular weight of 372.35 g/mol. Its IUPAC name is methyl 2-[(2R,3R,4R)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]benzoate.
Molecular Properties
| Compound Name | methyl 2-[(2R,3R,4R)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]benzoate |
| PubChem CID | 75409825 |
| Molecular Formula | C20H17FO6 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | methyl 2-[(2R,3R,4R)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]benzoate |
| SMILES | COC(=O)c1ccccc1[C@H]1OC(=O)[C@](C)(F)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H17FO6/c1-20(21)16(27-17(22)12-8-4-3-5-9-12)15(26-19(20)24)13-10-6-7-11-14(13)18(23)25-2/h3-11,15-16H,1-2H3/t15-,16-,20-/m1/s1 |
| InChIKey | QDSWQBSVHUDEKE-JXXFODFXSA-N |
| XLogP | 3.02 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(2R,3R,4R)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2R,3R,4R)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]benzoate?
The IUPAC name of methyl 2-[(2R,3R,4R)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]benzoate (CID 75409825) is methyl 2-[(2R,3R,4R)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]benzoate.
What is the SMILES notation for methyl 2-[(2R,3R,4R)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]benzoate?
The canonical SMILES for methyl 2-[(2R,3R,4R)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]benzoate is COC(=O)c1ccccc1[C@H]1OC(=O)[C@](C)(F)[C@@H]1OC(=O)c1ccccc1.
What is the InChIKey of methyl 2-[(2R,3R,4R)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]benzoate?
The InChIKey is QDSWQBSVHUDEKE-JXXFODFXSA-N. The full InChI is InChI=1S/C20H17FO6/c1-20(21)16(27-17(22)12-8-4-3-5-9-12)15(26-19(20)24)13-10-6-7-11-14(13)18(23)25-2/h3-11,15-16H,1-2H3/t15-,16-,20-/m1/s1.
What are the key properties of methyl 2-[(2R,3R,4R)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]benzoate?
methyl 2-[(2R,3R,4R)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]benzoate has a molecular weight of 372.35 g/mol, XLogP of 3.02, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2R,3R,4R)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]benzoate is sourced from PubChem (CID 75409825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).