C19H18N2O6S — CID 75410042
2-[(1S,11S)-12-(benzenesulfonyl)-10-oxo-2-oxa-9,12-diazatricyclo[9.2.1.03,8]tetradeca-3,5,7-trien-9-yl]acetic acid (PubChem CID 75410042) has the molecular formula C19H18N2O6S and a molecular weight of 402.43 g/mol. Its IUPAC name is 2-[(1S,11S)-12-(benzenesulfonyl)-10-oxo-2-oxa-9,12-diazatricyclo[9.2.1.03,8]tetradeca-3,5,7-trien-9-yl]acetic acid.
| Compound Name | 2-[(1S,11S)-12-(benzenesulfonyl)-10-oxo-2-oxa-9,12-diazatricyclo[9.2.1.03,8]tetradeca-3,5,7-trien-9-yl]acetic acid |
|---|---|
| PubChem CID | 75410042 |
| Molecular Formula | C19H18N2O6S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 2-[(1S,11S)-12-(benzenesulfonyl)-10-oxo-2-oxa-9,12-diazatricyclo[9.2.1.03,8]tetradeca-3,5,7-trien-9-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)[C@@H]2C[C@@H](CN2S(=O)(=O)c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C19H18N2O6S/c22-18(23)12-20-15-8-4-5-9-17(15)27-13-10-16(19(20)24)21(11-13)28(25,26)14-6-2-1-3-7-14/h1-9,13,16H,10-12H2,(H,22,23)/t13-,16-/m0/s1 |
| InChIKey | GNFKUIDDPADARC-BBRMVZONSA-N |
| XLogP | 1.33 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |