C25H23N3O4 — CID 75410274
(1S,11S)-12-(1,3-benzodioxol-5-ylmethyl)-9-(pyridin-2-ylmethyl)-2-oxa-9,12-diazatricyclo[9.2.1.03,8]tetradeca-3,5,7-trien-10-one (PubChem CID 75410274) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is (1S,11S)-12-(1,3-benzodioxol-5-ylmethyl)-9-(pyridin-2-ylmethyl)-2-oxa-9,12-diazatricyclo[9.2.1.03,8]tetradeca-3,5,7-trien-10-one.
| Compound Name | (1S,11S)-12-(1,3-benzodioxol-5-ylmethyl)-9-(pyridin-2-ylmethyl)-2-oxa-9,12-diazatricyclo[9.2.1.03,8]tetradeca-3,5,7-trien-10-one |
|---|---|
| PubChem CID | 75410274 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | (1S,11S)-12-(1,3-benzodioxol-5-ylmethyl)-9-(pyridin-2-ylmethyl)-2-oxa-9,12-diazatricyclo[9.2.1.03,8]tetradeca-3,5,7-trien-10-one |
| SMILES | O=C1[C@@H]2C[C@@H](CN2Cc2ccc3c(c2)OCO3)Oc2ccccc2N1Cc1ccccn1 |
| InChI | InChI=1S/C25H23N3O4/c29-25-21-12-19(15-27(21)13-17-8-9-23-24(11-17)31-16-30-23)32-22-7-2-1-6-20(22)28(25)14-18-5-3-4-10-26-18/h1-11,19,21H,12-16H2/t19-,21-/m0/s1 |
| InChIKey | ZAIHFSRGFBBZTN-FPOVZHCZSA-N |
| XLogP | 3.38 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |