C21H21N5O2 — CID 75410281
(1S,11S)-12-(1H-imidazol-2-ylmethyl)-9-(pyridin-2-ylmethyl)-2-oxa-9,12-diazatricyclo[9.2.1.03,8]tetradeca-3,5,7-trien-10-one (PubChem CID 75410281) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is (1S,11S)-12-(1H-imidazol-2-ylmethyl)-9-(pyridin-2-ylmethyl)-2-oxa-9,12-diazatricyclo[9.2.1.03,8]tetradeca-3,5,7-trien-10-one.
| Compound Name | (1S,11S)-12-(1H-imidazol-2-ylmethyl)-9-(pyridin-2-ylmethyl)-2-oxa-9,12-diazatricyclo[9.2.1.03,8]tetradeca-3,5,7-trien-10-one |
|---|---|
| PubChem CID | 75410281 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (1S,11S)-12-(1H-imidazol-2-ylmethyl)-9-(pyridin-2-ylmethyl)-2-oxa-9,12-diazatricyclo[9.2.1.03,8]tetradeca-3,5,7-trien-10-one |
| SMILES | O=C1[C@@H]2C[C@@H](CN2Cc2ncc[nH]2)Oc2ccccc2N1Cc1ccccn1 |
| InChI | InChI=1S/C21H21N5O2/c27-21-18-11-16(13-25(18)14-20-23-9-10-24-20)28-19-7-2-1-6-17(19)26(21)12-15-5-3-4-8-22-15/h1-10,16,18H,11-14H2,(H,23,24)/t16-,18-/m0/s1 |
| InChIKey | BJIXBMUKKXHHOV-WMZOPIPTSA-N |
| XLogP | 2.37 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |