About 2-[[(3S,4R)-4-fluoro-1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]oxymethyl]-1,3-benzoxazole
2-[[(3S,4R)-4-fluoro-1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]oxymethyl]-1,3-benzoxazole (PubChem CID 75410503) has the molecular formula C19H18F2N2O2
and a molecular weight of 344.36 g/mol. Its IUPAC name is 2-[[(3S,4R)-4-fluoro-1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]oxymethyl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[[(3S,4R)-4-fluoro-1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]oxymethyl]-1,3-benzoxazole |
| PubChem CID | 75410503 |
| Molecular Formula | C19H18F2N2O2 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-[[(3S,4R)-4-fluoro-1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]oxymethyl]-1,3-benzoxazole |
| SMILES | Fc1ccc(CN2C[C@@H](F)[C@@H](OCc3nc4ccccc4o3)C2)cc1 |
| InChI | InChI=1S/C19H18F2N2O2/c20-14-7-5-13(6-8-14)9-23-10-15(21)18(11-23)24-12-19-22-16-3-1-2-4-17(16)25-19/h1-8,15,18H,9-12H2/t15-,18+/m1/s1 |
| InChIKey | YLXZOGSJFZSDNZ-QAPCUYQASA-N |
| XLogP | 3.71 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[(3S,4R)-4-fluoro-1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]oxymethyl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3S,4R)-4-fluoro-1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]oxymethyl]-1,3-benzoxazole?
The IUPAC name of 2-[[(3S,4R)-4-fluoro-1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]oxymethyl]-1,3-benzoxazole (CID 75410503) is 2-[[(3S,4R)-4-fluoro-1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]oxymethyl]-1,3-benzoxazole.
What is the SMILES notation for 2-[[(3S,4R)-4-fluoro-1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]oxymethyl]-1,3-benzoxazole?
The canonical SMILES for 2-[[(3S,4R)-4-fluoro-1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]oxymethyl]-1,3-benzoxazole is Fc1ccc(CN2C[C@@H](F)[C@@H](OCc3nc4ccccc4o3)C2)cc1.
What is the InChIKey of 2-[[(3S,4R)-4-fluoro-1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]oxymethyl]-1,3-benzoxazole?
The InChIKey is YLXZOGSJFZSDNZ-QAPCUYQASA-N. The full InChI is InChI=1S/C19H18F2N2O2/c20-14-7-5-13(6-8-14)9-23-10-15(21)18(11-23)24-12-19-22-16-3-1-2-4-17(16)25-19/h1-8,15,18H,9-12H2/t15-,18+/m1/s1.
What are the key properties of 2-[[(3S,4R)-4-fluoro-1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]oxymethyl]-1,3-benzoxazole?
2-[[(3S,4R)-4-fluoro-1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]oxymethyl]-1,3-benzoxazole has a molecular weight of 344.36 g/mol, XLogP of 3.71, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3S,4R)-4-fluoro-1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]oxymethyl]-1,3-benzoxazole is sourced from PubChem (CID 75410503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).