C16H23N5O — CID 75411205
1-methyl-N-[[(13S)-11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-13-yl]methyl]piperidin-4-amine (PubChem CID 75411205) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-methyl-N-[[(13S)-11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-13-yl]methyl]piperidin-4-amine.
| Compound Name | 1-methyl-N-[[(13S)-11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-13-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 75411205 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 1-methyl-N-[[(13S)-11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-13-yl]methyl]piperidin-4-amine |
| SMILES | CN1CCC(NC[C@H]2COCc3nc4cccnc4n32)CC1 |
| InChI | InChI=1S/C16H23N5O/c1-20-7-4-12(5-8-20)18-9-13-10-22-11-15-19-14-3-2-6-17-16(14)21(13)15/h2-3,6,12-13,18H,4-5,7-11H2,1H3/t13-/m0/s1 |
| InChIKey | RFOCFKONWBIJQP-ZDUSSCGKSA-N |
| XLogP | 1.19 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |