C15H20N4O2 — CID 75411206
N-[[(13S)-11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-13-yl]methyl]oxan-4-amine (PubChem CID 75411206) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-[[(13S)-11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-13-yl]methyl]oxan-4-amine.
| Compound Name | N-[[(13S)-11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-13-yl]methyl]oxan-4-amine |
|---|---|
| PubChem CID | 75411206 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-[[(13S)-11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-13-yl]methyl]oxan-4-amine |
| SMILES | c1cnc2c(c1)nc1n2[C@@H](CNC2CCOCC2)COC1 |
| InChI | InChI=1S/C15H20N4O2/c1-2-13-15(16-5-1)19-12(9-21-10-14(19)18-13)8-17-11-3-6-20-7-4-11/h1-2,5,11-12,17H,3-4,6-10H2/t12-/m0/s1 |
| InChIKey | UDXWROOOKMRSGT-LBPRGKRZSA-N |
| XLogP | 1.27 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |