C17H19N5O — CID 75411209
N-[(6-methyl-2-pyridinyl)methyl]-1-[(13S)-11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-13-yl]methanamine (PubChem CID 75411209) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is N-[(6-methyl-2-pyridinyl)methyl]-1-[(13S)-11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-13-yl]methanamine.
| Compound Name | N-[(6-methyl-2-pyridinyl)methyl]-1-[(13S)-11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-13-yl]methanamine |
|---|---|
| PubChem CID | 75411209 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | N-[(6-methyl-2-pyridinyl)methyl]-1-[(13S)-11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-13-yl]methanamine |
| SMILES | Cc1cccc(CNC[C@H]2COCc3nc4cccnc4n32)n1 |
| InChI | InChI=1S/C17H19N5O/c1-12-4-2-5-13(20-12)8-18-9-14-10-23-11-16-21-15-6-3-7-19-17(15)22(14)16/h2-7,14,18H,8-11H2,1H3/t14-/m0/s1 |
| InChIKey | OCNFZFHTSMSJPW-AWEZNQCLSA-N |
| XLogP | 2.00 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |