About (6R)-4-(4-methoxyphenyl)sulfonyl-6-phenoxy-1,4-oxazepane
(6R)-4-(4-methoxyphenyl)sulfonyl-6-phenoxy-1,4-oxazepane (PubChem CID 75411592) has the molecular formula C18H21NO5S
and a molecular weight of 363.44 g/mol. Its IUPAC name is (6R)-4-(4-methoxyphenyl)sulfonyl-6-phenoxy-1,4-oxazepane.
Molecular Properties
| Compound Name | (6R)-4-(4-methoxyphenyl)sulfonyl-6-phenoxy-1,4-oxazepane |
| PubChem CID | 75411592 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (6R)-4-(4-methoxyphenyl)sulfonyl-6-phenoxy-1,4-oxazepane |
| SMILES | COc1ccc(S(=O)(=O)N2CCOC[C@H](Oc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C18H21NO5S/c1-22-15-7-9-18(10-8-15)25(20,21)19-11-12-23-14-17(13-19)24-16-5-3-2-4-6-16/h2-10,17H,11-14H2,1H3/t17-/m1/s1 |
| InChIKey | AYTDXHXGQKIAMC-QGZVFWFLSA-N |
| XLogP | 2.16 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (6R)-4-(4-methoxyphenyl)sulfonyl-6-phenoxy-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-4-(4-methoxyphenyl)sulfonyl-6-phenoxy-1,4-oxazepane?
The IUPAC name of (6R)-4-(4-methoxyphenyl)sulfonyl-6-phenoxy-1,4-oxazepane (CID 75411592) is (6R)-4-(4-methoxyphenyl)sulfonyl-6-phenoxy-1,4-oxazepane.
What is the SMILES notation for (6R)-4-(4-methoxyphenyl)sulfonyl-6-phenoxy-1,4-oxazepane?
The canonical SMILES for (6R)-4-(4-methoxyphenyl)sulfonyl-6-phenoxy-1,4-oxazepane is COc1ccc(S(=O)(=O)N2CCOC[C@H](Oc3ccccc3)C2)cc1.
What is the InChIKey of (6R)-4-(4-methoxyphenyl)sulfonyl-6-phenoxy-1,4-oxazepane?
The InChIKey is AYTDXHXGQKIAMC-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H21NO5S/c1-22-15-7-9-18(10-8-15)25(20,21)19-11-12-23-14-17(13-19)24-16-5-3-2-4-6-16/h2-10,17H,11-14H2,1H3/t17-/m1/s1.
What are the key properties of (6R)-4-(4-methoxyphenyl)sulfonyl-6-phenoxy-1,4-oxazepane?
(6R)-4-(4-methoxyphenyl)sulfonyl-6-phenoxy-1,4-oxazepane has a molecular weight of 363.44 g/mol, XLogP of 2.16, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-4-(4-methoxyphenyl)sulfonyl-6-phenoxy-1,4-oxazepane is sourced from PubChem (CID 75411592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).