C8H10N2S — CID 7541200
2-methyl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione (PubChem CID 7541200) has the molecular formula C8H10N2S and a molecular weight of 166.25 g/mol. Its IUPAC name is 2-methyl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione.
| Compound Name | 2-methyl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 7541200 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2-methyl-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione |
| SMILES | Cc1nc(=S)c2c([nH]1)CCC2 |
| InChI | InChI=1S/C8H10N2S/c1-5-9-7-4-2-3-6(7)8(11)10-5/h2-4H2,1H3,(H,9,10,11) |
| InChIKey | GXQMNTDEPAOBRK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|