C19H24O4 — CID 75412004
3-ethenyl-11b-hydroxy-3,8,8-trimethyl-2,9,10,11-tetrahydro-1H-benzo[d][2]benzoxepine-5,7-dione (PubChem CID 75412004) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-ethenyl-11b-hydroxy-3,8,8-trimethyl-2,9,10,11-tetrahydro-1H-benzo[d][2]benzoxepine-5,7-dione.
| Compound Name | 3-ethenyl-11b-hydroxy-3,8,8-trimethyl-2,9,10,11-tetrahydro-1H-benzo[d][2]benzoxepine-5,7-dione |
|---|---|
| PubChem CID | 75412004 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 3-ethenyl-11b-hydroxy-3,8,8-trimethyl-2,9,10,11-tetrahydro-1H-benzo[d][2]benzoxepine-5,7-dione |
| SMILES | C=CC1(C)C=C2C(=O)OC(=O)C3=C(CCCC3(C)C)C2(O)CC1 |
| InChI | InChI=1S/C19H24O4/c1-5-18(4)9-10-19(22)12-7-6-8-17(2,3)14(12)16(21)23-15(20)13(19)11-18/h5,11,22H,1,6-10H2,2-4H3 |
| InChIKey | SPAOQMDWHWSIOV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|