About CID 75412071
CID 75412071 (PubChem CID 75412071) has the molecular formula C3H2BF3K
and a molecular weight of 144.95 g/mol.
Molecular Properties
| Compound Name | CID 75412071 |
| PubChem CID | 75412071 |
| Molecular Formula | C3H2BF3K |
| Molecular Weight | 144.95 g/mol |
| Exact Mass | 144.98 |
| IUPAC Name | — |
| SMILES | [B-]C(CF)=C(F)F.[K+] |
| InChI | InChI=1S/C3H2BF3.K/c4-2(1-5)3(6)7;/h1H2;/q-1;+1 |
| InChIKey | HQMJRYJXESMCAD-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.95 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 75412071 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 75412071?
The IUPAC name of CID 75412071 (CID 75412071) is not available.
What is the SMILES notation for CID 75412071?
The canonical SMILES for CID 75412071 is [B-]C(CF)=C(F)F.[K+].
What is the InChIKey of CID 75412071?
The InChIKey is HQMJRYJXESMCAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2BF3.K/c4-2(1-5)3(6)7;/h1H2;/q-1;+1.
What are the key properties of CID 75412071?
CID 75412071 has a molecular weight of 144.95 g/mol, XLogP of -1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 75412071 is sourced from PubChem (CID 75412071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).