About CID 75412072
CID 75412072 (PubChem CID 75412072) has the molecular formula C3H2BF3-
and a molecular weight of 105.85 g/mol.
Molecular Properties
| Compound Name | CID 75412072 |
| PubChem CID | 75412072 |
| Molecular Formula | C3H2BF3- |
| Molecular Weight | 105.85 g/mol |
| Exact Mass | 106.02 |
| IUPAC Name | — |
| SMILES | [B-]C(CF)=C(F)F |
| InChI | InChI=1S/C3H2BF3/c4-2(1-5)3(6)7/h1H2/q-1 |
| InChIKey | VJZYWFJFQHKIQK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.85 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 75412072 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 75412072?
The IUPAC name of CID 75412072 (CID 75412072) is not available.
What is the SMILES notation for CID 75412072?
The canonical SMILES for CID 75412072 is [B-]C(CF)=C(F)F.
What is the InChIKey of CID 75412072?
The InChIKey is VJZYWFJFQHKIQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2BF3/c4-2(1-5)3(6)7/h1H2/q-1.
What are the key properties of CID 75412072?
CID 75412072 has a molecular weight of 105.85 g/mol, XLogP of 1.23, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 75412072 is sourced from PubChem (CID 75412072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).