C35H52ClO2P — CID 75412135
[3-chloro-2,5-dimethoxy-6-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-dicyclohexylphosphane (PubChem CID 75412135) has the molecular formula C35H52ClO2P and a molecular weight of 571.23 g/mol. Its IUPAC name is [3-chloro-2,5-dimethoxy-6-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-dicyclohexylphosphane.
| Compound Name | [3-chloro-2,5-dimethoxy-6-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-dicyclohexylphosphane |
|---|---|
| PubChem CID | 75412135 |
| Molecular Formula | C35H52ClO2P |
| Molecular Weight | 571.23 g/mol |
| Exact Mass | 570.34 |
| IUPAC Name | [3-chloro-2,5-dimethoxy-6-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-dicyclohexylphosphane |
| SMILES | COc1cc(Cl)c(OC)c(P(C2CCCCC2)C2CCCCC2)c1-c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C35H52ClO2P/c1-22(2)25-19-28(23(3)4)32(29(20-25)24(5)6)33-31(37-7)21-30(36)34(38-8)35(33)39(26-15-11-9-12-16-26)27-17-13-10-14-18-27/h19-24,26-27H,9-18H2,1-8H3 |
| InChIKey | GNFBFGBZWGRHHK-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.23 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|