About phenyl 4-(2,2-dimethylpropylcarbamoyl)-1H-imidazole-5-carboxylate
phenyl 4-(2,2-dimethylpropylcarbamoyl)-1H-imidazole-5-carboxylate (PubChem CID 75412487) has the molecular formula C16H19N3O3
and a molecular weight of 301.35 g/mol. Its IUPAC name is phenyl 4-(2,2-dimethylpropylcarbamoyl)-1H-imidazole-5-carboxylate.
Molecular Properties
| Compound Name | phenyl 4-(2,2-dimethylpropylcarbamoyl)-1H-imidazole-5-carboxylate |
| PubChem CID | 75412487 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | phenyl 4-(2,2-dimethylpropylcarbamoyl)-1H-imidazole-5-carboxylate |
| SMILES | CC(C)(C)CNC(=O)c1nc[nH]c1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C16H19N3O3/c1-16(2,3)9-17-14(20)12-13(19-10-18-12)15(21)22-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | RNFLLRTWWIQDSH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 4-(2,2-dimethylpropylcarbamoyl)-1H-imidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 4-(2,2-dimethylpropylcarbamoyl)-1H-imidazole-5-carboxylate?
The IUPAC name of phenyl 4-(2,2-dimethylpropylcarbamoyl)-1H-imidazole-5-carboxylate (CID 75412487) is phenyl 4-(2,2-dimethylpropylcarbamoyl)-1H-imidazole-5-carboxylate.
What is the SMILES notation for phenyl 4-(2,2-dimethylpropylcarbamoyl)-1H-imidazole-5-carboxylate?
The canonical SMILES for phenyl 4-(2,2-dimethylpropylcarbamoyl)-1H-imidazole-5-carboxylate is CC(C)(C)CNC(=O)c1nc[nH]c1C(=O)Oc1ccccc1.
What is the InChIKey of phenyl 4-(2,2-dimethylpropylcarbamoyl)-1H-imidazole-5-carboxylate?
The InChIKey is RNFLLRTWWIQDSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O3/c1-16(2,3)9-17-14(20)12-13(19-10-18-12)15(21)22-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3,(H,17,20)(H,18,19).
What are the key properties of phenyl 4-(2,2-dimethylpropylcarbamoyl)-1H-imidazole-5-carboxylate?
phenyl 4-(2,2-dimethylpropylcarbamoyl)-1H-imidazole-5-carboxylate has a molecular weight of 301.35 g/mol, XLogP of 2.40, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 4-(2,2-dimethylpropylcarbamoyl)-1H-imidazole-5-carboxylate is sourced from PubChem (CID 75412487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).