About (3,3-dimethyl-2-oxobutyl) 5-methylimidazo[1,2-a]pyridine-2-carboxylate
(3,3-dimethyl-2-oxobutyl) 5-methylimidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 75412698) has the molecular formula C15H18N2O3
and a molecular weight of 274.32 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 5-methylimidazo[1,2-a]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | (3,3-dimethyl-2-oxobutyl) 5-methylimidazo[1,2-a]pyridine-2-carboxylate |
| PubChem CID | 75412698 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 5-methylimidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | Cc1cccc2nc(C(=O)OCC(=O)C(C)(C)C)cn12 |
| InChI | InChI=1S/C15H18N2O3/c1-10-6-5-7-13-16-11(8-17(10)13)14(19)20-9-12(18)15(2,3)4/h5-8H,9H2,1-4H3 |
| InChIKey | YHKJRAOOQSELKP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3,3-dimethyl-2-oxobutyl) 5-methylimidazo[1,2-a]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dimethyl-2-oxobutyl) 5-methylimidazo[1,2-a]pyridine-2-carboxylate?
The IUPAC name of (3,3-dimethyl-2-oxobutyl) 5-methylimidazo[1,2-a]pyridine-2-carboxylate (CID 75412698) is (3,3-dimethyl-2-oxobutyl) 5-methylimidazo[1,2-a]pyridine-2-carboxylate.
What is the SMILES notation for (3,3-dimethyl-2-oxobutyl) 5-methylimidazo[1,2-a]pyridine-2-carboxylate?
The canonical SMILES for (3,3-dimethyl-2-oxobutyl) 5-methylimidazo[1,2-a]pyridine-2-carboxylate is Cc1cccc2nc(C(=O)OCC(=O)C(C)(C)C)cn12.
What is the InChIKey of (3,3-dimethyl-2-oxobutyl) 5-methylimidazo[1,2-a]pyridine-2-carboxylate?
The InChIKey is YHKJRAOOQSELKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3/c1-10-6-5-7-13-16-11(8-17(10)13)14(19)20-9-12(18)15(2,3)4/h5-8H,9H2,1-4H3.
What are the key properties of (3,3-dimethyl-2-oxobutyl) 5-methylimidazo[1,2-a]pyridine-2-carboxylate?
(3,3-dimethyl-2-oxobutyl) 5-methylimidazo[1,2-a]pyridine-2-carboxylate has a molecular weight of 274.32 g/mol, XLogP of 2.41, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethyl-2-oxobutyl) 5-methylimidazo[1,2-a]pyridine-2-carboxylate is sourced from PubChem (CID 75412698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).