C18H19N3O2 — CID 75413608
butyl (E)-2-cyano-3-[5-(4-methylphenyl)-1H-pyrazol-4-yl]prop-2-enoate (PubChem CID 75413608) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is butyl (E)-2-cyano-3-[5-(4-methylphenyl)-1H-pyrazol-4-yl]prop-2-enoate.
| Compound Name | butyl (E)-2-cyano-3-[5-(4-methylphenyl)-1H-pyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 75413608 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | butyl (E)-2-cyano-3-[5-(4-methylphenyl)-1H-pyrazol-4-yl]prop-2-enoate |
| SMILES | CCCCOC(=O)/C(C#N)=C/c1cn[nH]c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C18H19N3O2/c1-3-4-9-23-18(22)15(11-19)10-16-12-20-21-17(16)14-7-5-13(2)6-8-14/h5-8,10,12H,3-4,9H2,1-2H3,(H,20,21)/b15-10+ |
| InChIKey | FWVJBEPAKKLKFZ-XNTDXEJSSA-N |
| XLogP | 3.64 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|