About (3,5-dimethyl-1,2-oxazol-4-yl)methyl morpholine-4-carboximidothioate;hydrochloride
(3,5-dimethyl-1,2-oxazol-4-yl)methyl morpholine-4-carboximidothioate;hydrochloride (PubChem CID 75413752) has the molecular formula C11H18ClN3O2S
and a molecular weight of 291.80 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)methyl morpholine-4-carboximidothioate;hydrochloride.
Molecular Properties
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl morpholine-4-carboximidothioate;hydrochloride |
| PubChem CID | 75413752 |
| Molecular Formula | C11H18ClN3O2S |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl morpholine-4-carboximidothioate;hydrochloride |
| SMILES | Cl.[H]/N=C(\SCc1c(C)noc1C)N1CCOCC1 |
| InChI | InChI=1S/C11H17N3O2S.ClH/c1-8-10(9(2)16-13-8)7-17-11(12)14-3-5-15-6-4-14;/h12H,3-7H2,1-2H3;1H/b12-11-; |
| InChIKey | LXWWIFBFKIUGSJ-AFEZEDKISA-N |
| XLogP | 2.21 |
| TPSA | 62.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dimethyl-1,2-oxazol-4-yl)methyl morpholine-4-carboximidothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethyl-1,2-oxazol-4-yl)methyl morpholine-4-carboximidothioate;hydrochloride?
The IUPAC name of (3,5-dimethyl-1,2-oxazol-4-yl)methyl morpholine-4-carboximidothioate;hydrochloride (CID 75413752) is (3,5-dimethyl-1,2-oxazol-4-yl)methyl morpholine-4-carboximidothioate;hydrochloride.
What is the SMILES notation for (3,5-dimethyl-1,2-oxazol-4-yl)methyl morpholine-4-carboximidothioate;hydrochloride?
The canonical SMILES for (3,5-dimethyl-1,2-oxazol-4-yl)methyl morpholine-4-carboximidothioate;hydrochloride is Cl.[H]/N=C(\SCc1c(C)noc1C)N1CCOCC1.
What is the InChIKey of (3,5-dimethyl-1,2-oxazol-4-yl)methyl morpholine-4-carboximidothioate;hydrochloride?
The InChIKey is LXWWIFBFKIUGSJ-AFEZEDKISA-N. The full InChI is InChI=1S/C11H17N3O2S.ClH/c1-8-10(9(2)16-13-8)7-17-11(12)14-3-5-15-6-4-14;/h12H,3-7H2,1-2H3;1H/b12-11-;.
What are the key properties of (3,5-dimethyl-1,2-oxazol-4-yl)methyl morpholine-4-carboximidothioate;hydrochloride?
(3,5-dimethyl-1,2-oxazol-4-yl)methyl morpholine-4-carboximidothioate;hydrochloride has a molecular weight of 291.80 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethyl-1,2-oxazol-4-yl)methyl morpholine-4-carboximidothioate;hydrochloride is sourced from PubChem (CID 75413752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).