About 6-bromo-7-[[(E)-3-phenylprop-2-enyl]sulfinylmethyl]-2,3-dihydro-1,4-benzodioxine
6-bromo-7-[[(E)-3-phenylprop-2-enyl]sulfinylmethyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 75414170) has the molecular formula C18H17BrO3S
and a molecular weight of 393.30 g/mol. Its IUPAC name is 6-bromo-7-[[(E)-3-phenylprop-2-enyl]sulfinylmethyl]-2,3-dihydro-1,4-benzodioxine.
Molecular Properties
| Compound Name | 6-bromo-7-[[(E)-3-phenylprop-2-enyl]sulfinylmethyl]-2,3-dihydro-1,4-benzodioxine |
| PubChem CID | 75414170 |
| Molecular Formula | C18H17BrO3S |
| Molecular Weight | 393.30 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 6-bromo-7-[[(E)-3-phenylprop-2-enyl]sulfinylmethyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | O=S(C/C=C/c1ccccc1)Cc1cc2c(cc1Br)OCCO2 |
| InChI | InChI=1S/C18H17BrO3S/c19-16-12-18-17(21-8-9-22-18)11-15(16)13-23(20)10-4-7-14-5-2-1-3-6-14/h1-7,11-12H,8-10,13H2/b7-4+ |
| InChIKey | WYIKTHVVEXQIKL-QPJJXVBHSA-N |
| XLogP | 4.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-7-[[(E)-3-phenylprop-2-enyl]sulfinylmethyl]-2,3-dihydro-1,4-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-7-[[(E)-3-phenylprop-2-enyl]sulfinylmethyl]-2,3-dihydro-1,4-benzodioxine?
The IUPAC name of 6-bromo-7-[[(E)-3-phenylprop-2-enyl]sulfinylmethyl]-2,3-dihydro-1,4-benzodioxine (CID 75414170) is 6-bromo-7-[[(E)-3-phenylprop-2-enyl]sulfinylmethyl]-2,3-dihydro-1,4-benzodioxine.
What is the SMILES notation for 6-bromo-7-[[(E)-3-phenylprop-2-enyl]sulfinylmethyl]-2,3-dihydro-1,4-benzodioxine?
The canonical SMILES for 6-bromo-7-[[(E)-3-phenylprop-2-enyl]sulfinylmethyl]-2,3-dihydro-1,4-benzodioxine is O=S(C/C=C/c1ccccc1)Cc1cc2c(cc1Br)OCCO2.
What is the InChIKey of 6-bromo-7-[[(E)-3-phenylprop-2-enyl]sulfinylmethyl]-2,3-dihydro-1,4-benzodioxine?
The InChIKey is WYIKTHVVEXQIKL-QPJJXVBHSA-N. The full InChI is InChI=1S/C18H17BrO3S/c19-16-12-18-17(21-8-9-22-18)11-15(16)13-23(20)10-4-7-14-5-2-1-3-6-14/h1-7,11-12H,8-10,13H2/b7-4+.
What are the key properties of 6-bromo-7-[[(E)-3-phenylprop-2-enyl]sulfinylmethyl]-2,3-dihydro-1,4-benzodioxine?
6-bromo-7-[[(E)-3-phenylprop-2-enyl]sulfinylmethyl]-2,3-dihydro-1,4-benzodioxine has a molecular weight of 393.30 g/mol, XLogP of 4.18, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-7-[[(E)-3-phenylprop-2-enyl]sulfinylmethyl]-2,3-dihydro-1,4-benzodioxine is sourced from PubChem (CID 75414170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).