C9H12ClFN2O — CID 75414598
2-amino-5-fluoro-N,N-dimethylbenzamide;hydrochloride (PubChem CID 75414598) has the molecular formula C9H12ClFN2O and a molecular weight of 218.66 g/mol. Its IUPAC name is 2-amino-5-fluoro-N,N-dimethylbenzamide;hydrochloride.
| Compound Name | 2-amino-5-fluoro-N,N-dimethylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 75414598 |
| Molecular Formula | C9H12ClFN2O |
| Molecular Weight | 218.66 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 2-amino-5-fluoro-N,N-dimethylbenzamide;hydrochloride |
| SMILES | CN(C)C(=O)c1cc(F)ccc1N.Cl |
| InChI | InChI=1S/C9H11FN2O.ClH/c1-12(2)9(13)7-5-6(10)3-4-8(7)11;/h3-5H,11H2,1-2H3;1H |
| InChIKey | WPDFIXCQNQIJGQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.66 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|