About 2-pyrazol-1-yl-N-[(2,3,4-trimethoxyphenyl)methyl]pyridin-3-amine
2-pyrazol-1-yl-N-[(2,3,4-trimethoxyphenyl)methyl]pyridin-3-amine (PubChem CID 75415259) has the molecular formula C18H20N4O3
and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-pyrazol-1-yl-N-[(2,3,4-trimethoxyphenyl)methyl]pyridin-3-amine.
Molecular Properties
| Compound Name | 2-pyrazol-1-yl-N-[(2,3,4-trimethoxyphenyl)methyl]pyridin-3-amine |
| PubChem CID | 75415259 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2-pyrazol-1-yl-N-[(2,3,4-trimethoxyphenyl)methyl]pyridin-3-amine |
| SMILES | COc1ccc(CNc2cccnc2-n2cccn2)c(OC)c1OC |
| InChI | InChI=1S/C18H20N4O3/c1-23-15-8-7-13(16(24-2)17(15)25-3)12-20-14-6-4-9-19-18(14)22-11-5-10-21-22/h4-11,20H,12H2,1-3H3 |
| InChIKey | OMBCWOHGHLOICH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 70.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-pyrazol-1-yl-N-[(2,3,4-trimethoxyphenyl)methyl]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazol-1-yl-N-[(2,3,4-trimethoxyphenyl)methyl]pyridin-3-amine?
The IUPAC name of 2-pyrazol-1-yl-N-[(2,3,4-trimethoxyphenyl)methyl]pyridin-3-amine (CID 75415259) is 2-pyrazol-1-yl-N-[(2,3,4-trimethoxyphenyl)methyl]pyridin-3-amine.
What is the SMILES notation for 2-pyrazol-1-yl-N-[(2,3,4-trimethoxyphenyl)methyl]pyridin-3-amine?
The canonical SMILES for 2-pyrazol-1-yl-N-[(2,3,4-trimethoxyphenyl)methyl]pyridin-3-amine is COc1ccc(CNc2cccnc2-n2cccn2)c(OC)c1OC.
What is the InChIKey of 2-pyrazol-1-yl-N-[(2,3,4-trimethoxyphenyl)methyl]pyridin-3-amine?
The InChIKey is OMBCWOHGHLOICH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O3/c1-23-15-8-7-13(16(24-2)17(15)25-3)12-20-14-6-4-9-19-18(14)22-11-5-10-21-22/h4-11,20H,12H2,1-3H3.
What are the key properties of 2-pyrazol-1-yl-N-[(2,3,4-trimethoxyphenyl)methyl]pyridin-3-amine?
2-pyrazol-1-yl-N-[(2,3,4-trimethoxyphenyl)methyl]pyridin-3-amine has a molecular weight of 340.38 g/mol, XLogP of 2.91, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazol-1-yl-N-[(2,3,4-trimethoxyphenyl)methyl]pyridin-3-amine is sourced from PubChem (CID 75415259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).