C18H15N3O3S — CID 75415291
N-[2-(benzenesulfonyl)ethyl]-[1]benzofuro[3,2-d]pyrimidin-4-amine (PubChem CID 75415291) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is N-[2-(benzenesulfonyl)ethyl]-[1]benzofuro[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[2-(benzenesulfonyl)ethyl]-[1]benzofuro[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 75415291 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | N-[2-(benzenesulfonyl)ethyl]-[1]benzofuro[3,2-d]pyrimidin-4-amine |
| SMILES | O=S(=O)(CCNc1ncnc2c1oc1ccccc12)c1ccccc1 |
| InChI | InChI=1S/C18H15N3O3S/c22-25(23,13-6-2-1-3-7-13)11-10-19-18-17-16(20-12-21-18)14-8-4-5-9-15(14)24-17/h1-9,12H,10-11H2,(H,19,20,21) |
| InChIKey | OASUCLOHVFSZEH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |