About 1,4-dimethylpiperidin-4-amine;dihydrochloride
1,4-dimethylpiperidin-4-amine;dihydrochloride (PubChem CID 75415550) has the molecular formula C7H18Cl2N2
and a molecular weight of 201.14 g/mol. Its IUPAC name is 1,4-dimethylpiperidin-4-amine;dihydrochloride.
Molecular Properties
| Compound Name | 1,4-dimethylpiperidin-4-amine;dihydrochloride |
| PubChem CID | 75415550 |
| Molecular Formula | C7H18Cl2N2 |
| Molecular Weight | 201.14 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 1,4-dimethylpiperidin-4-amine;dihydrochloride |
| SMILES | CN1CCC(C)(N)CC1.Cl.Cl |
| InChI | InChI=1S/C7H16N2.2ClH/c1-7(8)3-5-9(2)6-4-7;;/h3-6,8H2,1-2H3;2*1H |
| InChIKey | GNNKMCFUYAMVPJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.14 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dimethylpiperidin-4-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylpiperidin-4-amine;dihydrochloride?
The IUPAC name of 1,4-dimethylpiperidin-4-amine;dihydrochloride (CID 75415550) is 1,4-dimethylpiperidin-4-amine;dihydrochloride.
What is the SMILES notation for 1,4-dimethylpiperidin-4-amine;dihydrochloride?
The canonical SMILES for 1,4-dimethylpiperidin-4-amine;dihydrochloride is CN1CCC(C)(N)CC1.Cl.Cl.
What is the InChIKey of 1,4-dimethylpiperidin-4-amine;dihydrochloride?
The InChIKey is GNNKMCFUYAMVPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2.2ClH/c1-7(8)3-5-9(2)6-4-7;;/h3-6,8H2,1-2H3;2*1H.
What are the key properties of 1,4-dimethylpiperidin-4-amine;dihydrochloride?
1,4-dimethylpiperidin-4-amine;dihydrochloride has a molecular weight of 201.14 g/mol, XLogP of 1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylpiperidin-4-amine;dihydrochloride is sourced from PubChem (CID 75415550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).