About 4-(5,6-difluoro-1H-benzimidazol-2-yl)-2-(4-fluorophenyl)-1,3-thiazole
4-(5,6-difluoro-1H-benzimidazol-2-yl)-2-(4-fluorophenyl)-1,3-thiazole (PubChem CID 75415684) has the molecular formula C16H8F3N3S
and a molecular weight of 331.32 g/mol. Its IUPAC name is 4-(5,6-difluoro-1H-benzimidazol-2-yl)-2-(4-fluorophenyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(5,6-difluoro-1H-benzimidazol-2-yl)-2-(4-fluorophenyl)-1,3-thiazole |
| PubChem CID | 75415684 |
| Molecular Formula | C16H8F3N3S |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 4-(5,6-difluoro-1H-benzimidazol-2-yl)-2-(4-fluorophenyl)-1,3-thiazole |
| SMILES | Fc1ccc(-c2nc(-c3nc4cc(F)c(F)cc4[nH]3)cs2)cc1 |
| InChI | InChI=1S/C16H8F3N3S/c17-9-3-1-8(2-4-9)16-22-14(7-23-16)15-20-12-5-10(18)11(19)6-13(12)21-15/h1-7H,(H,20,21) |
| InChIKey | RMMQJFMSXLQFEK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5,6-difluoro-1H-benzimidazol-2-yl)-2-(4-fluorophenyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,6-difluoro-1H-benzimidazol-2-yl)-2-(4-fluorophenyl)-1,3-thiazole?
The IUPAC name of 4-(5,6-difluoro-1H-benzimidazol-2-yl)-2-(4-fluorophenyl)-1,3-thiazole (CID 75415684) is 4-(5,6-difluoro-1H-benzimidazol-2-yl)-2-(4-fluorophenyl)-1,3-thiazole.
What is the SMILES notation for 4-(5,6-difluoro-1H-benzimidazol-2-yl)-2-(4-fluorophenyl)-1,3-thiazole?
The canonical SMILES for 4-(5,6-difluoro-1H-benzimidazol-2-yl)-2-(4-fluorophenyl)-1,3-thiazole is Fc1ccc(-c2nc(-c3nc4cc(F)c(F)cc4[nH]3)cs2)cc1.
What is the InChIKey of 4-(5,6-difluoro-1H-benzimidazol-2-yl)-2-(4-fluorophenyl)-1,3-thiazole?
The InChIKey is RMMQJFMSXLQFEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8F3N3S/c17-9-3-1-8(2-4-9)16-22-14(7-23-16)15-20-12-5-10(18)11(19)6-13(12)21-15/h1-7H,(H,20,21).
What are the key properties of 4-(5,6-difluoro-1H-benzimidazol-2-yl)-2-(4-fluorophenyl)-1,3-thiazole?
4-(5,6-difluoro-1H-benzimidazol-2-yl)-2-(4-fluorophenyl)-1,3-thiazole has a molecular weight of 331.32 g/mol, XLogP of 4.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,6-difluoro-1H-benzimidazol-2-yl)-2-(4-fluorophenyl)-1,3-thiazole is sourced from PubChem (CID 75415684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).