C15H15N5O4 — CID 75416869
5-[4-(3-nitro-2-pyridinyl)piperazine-1-carbonyl]-1H-pyridin-2-one (PubChem CID 75416869) has the molecular formula C15H15N5O4 and a molecular weight of 329.32 g/mol. Its IUPAC name is 5-[4-(3-nitro-2-pyridinyl)piperazine-1-carbonyl]-1H-pyridin-2-one.
| Compound Name | 5-[4-(3-nitro-2-pyridinyl)piperazine-1-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 75416869 |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 5-[4-(3-nitro-2-pyridinyl)piperazine-1-carbonyl]-1H-pyridin-2-one |
| SMILES | O=C(c1ccc(=O)[nH]c1)N1CCN(c2ncccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H15N5O4/c21-13-4-3-11(10-17-13)15(22)19-8-6-18(7-9-19)14-12(20(23)24)2-1-5-16-14/h1-5,10H,6-9H2,(H,17,21) |
| InChIKey | OQBKONKESUFGTA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 112.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|