C13H18N2OS — CID 75416918
1-(2,3-dihydro-1H-inden-5-yl)-3-(2-hydroxypropyl)thiourea (PubChem CID 75416918) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-3-(2-hydroxypropyl)thiourea.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-3-(2-hydroxypropyl)thiourea |
|---|---|
| PubChem CID | 75416918 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-3-(2-hydroxypropyl)thiourea |
| SMILES | CC(O)CNC(=S)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H18N2OS/c1-9(16)8-14-13(17)15-12-6-5-10-3-2-4-11(10)7-12/h5-7,9,16H,2-4,8H2,1H3,(H2,14,15,17) |
| InChIKey | OSCHEQPBYJAYDQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|