About 3,3,3-trifluoropropyl 2-tert-butyl-1,3-thiazole-5-carboxylate
3,3,3-trifluoropropyl 2-tert-butyl-1,3-thiazole-5-carboxylate (PubChem CID 75417414) has the molecular formula C11H14F3NO2S
and a molecular weight of 281.30 g/mol. Its IUPAC name is 3,3,3-trifluoropropyl 2-tert-butyl-1,3-thiazole-5-carboxylate.
Analyze 3,3,3-trifluoropropyl 2-tert-butyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3,3-trifluoropropyl 2-tert-butyl-1,3-thiazole-5-carboxylate?
The IUPAC name of 3,3,3-trifluoropropyl 2-tert-butyl-1,3-thiazole-5-carboxylate (CID 75417414) is 3,3,3-trifluoropropyl 2-tert-butyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for 3,3,3-trifluoropropyl 2-tert-butyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for 3,3,3-trifluoropropyl 2-tert-butyl-1,3-thiazole-5-carboxylate is CC(C)(C)c1ncc(C(=O)OCCC(F)(F)F)s1.
What is the InChIKey of 3,3,3-trifluoropropyl 2-tert-butyl-1,3-thiazole-5-carboxylate?
The InChIKey is KIECZZSJOPWOOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3NO2S/c1-10(2,3)9-15-6-7(18-9)8(16)17-5-4-11(12,13)14/h6H,4-5H2,1-3H3.
What are the key properties of 3,3,3-trifluoropropyl 2-tert-butyl-1,3-thiazole-5-carboxylate?
3,3,3-trifluoropropyl 2-tert-butyl-1,3-thiazole-5-carboxylate has a molecular weight of 281.30 g/mol, XLogP of 3.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3,3-trifluoropropyl 2-tert-butyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 75417414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).