C20H18F3NO3 — CID 75417480
1-(1,3-benzodioxol-5-yl)-N-(2,3,4-trifluorophenyl)cyclohexane-1-carboxamide (PubChem CID 75417480) has the molecular formula C20H18F3NO3 and a molecular weight of 377.36 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-(2,3,4-trifluorophenyl)cyclohexane-1-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-(2,3,4-trifluorophenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 75417480 |
| Molecular Formula | C20H18F3NO3 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-(2,3,4-trifluorophenyl)cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)C1(c2ccc3c(c2)OCO3)CCCCC1 |
| InChI | InChI=1S/C20H18F3NO3/c21-13-5-6-14(18(23)17(13)22)24-19(25)20(8-2-1-3-9-20)12-4-7-15-16(10-12)27-11-26-15/h4-7,10H,1-3,8-9,11H2,(H,24,25) |
| InChIKey | AHPLWYUCLFQGEA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|