About (2-methoxy-2-oxoethyl) (E)-3-(1,3-thiazol-4-yl)prop-2-enoate
(2-methoxy-2-oxoethyl) (E)-3-(1,3-thiazol-4-yl)prop-2-enoate (PubChem CID 75418745) has the molecular formula C9H9NO4S
and a molecular weight of 227.24 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) (E)-3-(1,3-thiazol-4-yl)prop-2-enoate.
Molecular Properties
| Compound Name | (2-methoxy-2-oxoethyl) (E)-3-(1,3-thiazol-4-yl)prop-2-enoate |
| PubChem CID | 75418745 |
| Molecular Formula | C9H9NO4S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | (2-methoxy-2-oxoethyl) (E)-3-(1,3-thiazol-4-yl)prop-2-enoate |
| SMILES | COC(=O)COC(=O)/C=C/c1cscn1 |
| InChI | InChI=1S/C9H9NO4S/c1-13-9(12)4-14-8(11)3-2-7-5-15-6-10-7/h2-3,5-6H,4H2,1H3/b3-2+ |
| InChIKey | GHTJMAAGCVOFCH-NSCUHMNNSA-N |
| XLogP | 0.87 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxy-2-oxoethyl) (E)-3-(1,3-thiazol-4-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-2-oxoethyl) (E)-3-(1,3-thiazol-4-yl)prop-2-enoate?
The IUPAC name of (2-methoxy-2-oxoethyl) (E)-3-(1,3-thiazol-4-yl)prop-2-enoate (CID 75418745) is (2-methoxy-2-oxoethyl) (E)-3-(1,3-thiazol-4-yl)prop-2-enoate.
What is the SMILES notation for (2-methoxy-2-oxoethyl) (E)-3-(1,3-thiazol-4-yl)prop-2-enoate?
The canonical SMILES for (2-methoxy-2-oxoethyl) (E)-3-(1,3-thiazol-4-yl)prop-2-enoate is COC(=O)COC(=O)/C=C/c1cscn1.
What is the InChIKey of (2-methoxy-2-oxoethyl) (E)-3-(1,3-thiazol-4-yl)prop-2-enoate?
The InChIKey is GHTJMAAGCVOFCH-NSCUHMNNSA-N. The full InChI is InChI=1S/C9H9NO4S/c1-13-9(12)4-14-8(11)3-2-7-5-15-6-10-7/h2-3,5-6H,4H2,1H3/b3-2+.
What are the key properties of (2-methoxy-2-oxoethyl) (E)-3-(1,3-thiazol-4-yl)prop-2-enoate?
(2-methoxy-2-oxoethyl) (E)-3-(1,3-thiazol-4-yl)prop-2-enoate has a molecular weight of 227.24 g/mol, XLogP of 0.87, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-2-oxoethyl) (E)-3-(1,3-thiazol-4-yl)prop-2-enoate is sourced from PubChem (CID 75418745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).