C12H18IN3O — CID 75418971
N-(2-phenoxyethyl)-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 75418971) has the molecular formula C12H18IN3O and a molecular weight of 347.20 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-(2-phenoxyethyl)-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 75418971 |
| Molecular Formula | C12H18IN3O |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | N-(2-phenoxyethyl)-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | I.c1ccc(OCCNC2=NCCCN2)cc1 |
| InChI | InChI=1S/C12H17N3O.HI/c1-2-5-11(6-3-1)16-10-9-15-12-13-7-4-8-14-12;/h1-3,5-6H,4,7-10H2,(H2,13,14,15);1H |
| InChIKey | QIMXHCONNPDMCA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|