C13H23IN4O3S — CID 75419046
2-(furan-2-ylmethyl)-1-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide (PubChem CID 75419046) has the molecular formula C13H23IN4O3S and a molecular weight of 442.32 g/mol. Its IUPAC name is 2-(furan-2-ylmethyl)-1-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-(furan-2-ylmethyl)-1-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 75419046 |
| Molecular Formula | C13H23IN4O3S |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 2-(furan-2-ylmethyl)-1-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CS(=O)(=O)N1CCC(CN/C(N)=N/Cc2ccco2)CC1.I |
| InChI | InChI=1S/C13H22N4O3S.HI/c1-21(18,19)17-6-4-11(5-7-17)9-15-13(14)16-10-12-3-2-8-20-12;/h2-3,8,11H,4-7,9-10H2,1H3,(H3,14,15,16);1H |
| InChIKey | RGJBKBYJKFTEAU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 100.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|