C17H20N2O3 — CID 75419494
(1-methoxyisoquinolin-3-yl)-(3-methoxypiperidin-1-yl)methanone (PubChem CID 75419494) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is (1-methoxyisoquinolin-3-yl)-(3-methoxypiperidin-1-yl)methanone.
| Compound Name | (1-methoxyisoquinolin-3-yl)-(3-methoxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 75419494 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (1-methoxyisoquinolin-3-yl)-(3-methoxypiperidin-1-yl)methanone |
| SMILES | COc1nc(C(=O)N2CCCC(OC)C2)cc2ccccc12 |
| InChI | InChI=1S/C17H20N2O3/c1-21-13-7-5-9-19(11-13)17(20)15-10-12-6-3-4-8-14(12)16(18-15)22-2/h3-4,6,8,10,13H,5,7,9,11H2,1-2H3 |
| InChIKey | HDXCPEFADRKWLF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |