About potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate
potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate (PubChem CID 75419918) has the molecular formula C5H5KN2O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate.
Molecular Properties
| Compound Name | potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate |
| PubChem CID | 75419918 |
| Molecular Formula | C5H5KN2O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 195.99 |
| IUPAC Name | potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate |
| SMILES | COCc1nc(C(=O)[O-])no1.[K+] |
| InChI | InChI=1S/C5H6N2O4.K/c1-10-2-3-6-4(5(8)9)7-11-3;/h2H2,1H3,(H,8,9);/q;+1/p-1 |
| InChIKey | DGAQZTLUJLLRDN-UHFFFAOYSA-M |
| XLogP | -4.42 |
| TPSA | 88.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | -4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate?
The IUPAC name of potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate (CID 75419918) is potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate.
What is the SMILES notation for potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate?
The canonical SMILES for potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate is COCc1nc(C(=O)[O-])no1.[K+].
What is the InChIKey of potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate?
The InChIKey is DGAQZTLUJLLRDN-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H6N2O4.K/c1-10-2-3-6-4(5(8)9)7-11-3;/h2H2,1H3,(H,8,9);/q;+1/p-1.
What are the key properties of potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate?
potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate has a molecular weight of 196.20 g/mol, XLogP of -4.42, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate is sourced from PubChem (CID 75419918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).